C19H29FN2O2 — CID 71925965
N-tert-butyl-N-[(3-fluorophenyl)methyl]-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide (PubChem CID 71925965) has the molecular formula C19H29FN2O2 and a molecular weight of 336.45 g/mol. Its IUPAC name is N-tert-butyl-N-[(3-fluorophenyl)methyl]-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide.
| Compound Name | N-tert-butyl-N-[(3-fluorophenyl)methyl]-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 71925965 |
| Molecular Formula | C19H29FN2O2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-tert-butyl-N-[(3-fluorophenyl)methyl]-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide |
| SMILES | CC(C)(C)N(Cc1cccc(F)c1)C(=O)CN1CCCC(CO)C1 |
| InChI | InChI=1S/C19H29FN2O2/c1-19(2,3)22(12-15-6-4-8-17(20)10-15)18(24)13-21-9-5-7-16(11-21)14-23/h4,6,8,10,16,23H,5,7,9,11-14H2,1-3H3 |
| InChIKey | FXWVDCTWTHLTOV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |