C23H33FN4O3 — CID 78900758
N-tert-butyl-N-[(3-fluorophenyl)methyl]-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]acetamide (PubChem CID 78900758) has the molecular formula C23H33FN4O3 and a molecular weight of 432.54 g/mol. Its IUPAC name is N-tert-butyl-N-[(3-fluorophenyl)methyl]-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]acetamide.
| Compound Name | N-tert-butyl-N-[(3-fluorophenyl)methyl]-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 78900758 |
| Molecular Formula | C23H33FN4O3 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | N-tert-butyl-N-[(3-fluorophenyl)methyl]-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]acetamide |
| SMILES | CC(C)(C)N(Cc1cccc(F)c1)C(=O)CN1CCN(C(=O)C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C23H33FN4O3/c1-23(2,3)28(16-18-7-6-8-19(24)15-18)20(29)17-25-11-13-27(14-12-25)22(31)21(30)26-9-4-5-10-26/h6-8,15H,4-5,9-14,16-17H2,1-3H3 |
| InChIKey | NBHCBVQYIQLWDF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|