C13H13N5O5 — CID 167951103
1-methyl-4-[[(4-methyl-6-nitropyridine-3-carbonyl)amino]methyl]pyrazole-5-carboxylic acid (PubChem CID 167951103) has the molecular formula C13H13N5O5 and a molecular weight of 319.28 g/mol. Its IUPAC name is 1-methyl-4-[[(4-methyl-6-nitropyridine-3-carbonyl)amino]methyl]pyrazole-5-carboxylic acid.
| Compound Name | 1-methyl-4-[[(4-methyl-6-nitropyridine-3-carbonyl)amino]methyl]pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 167951103 |
| Molecular Formula | C13H13N5O5 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 1-methyl-4-[[(4-methyl-6-nitropyridine-3-carbonyl)amino]methyl]pyrazole-5-carboxylic acid |
| SMILES | Cc1cc([N+](=O)[O-])ncc1C(=O)NCc1cnn(C)c1C(=O)O |
| InChI | InChI=1S/C13H13N5O5/c1-7-3-10(18(22)23)14-6-9(7)12(19)15-4-8-5-16-17(2)11(8)13(20)21/h3,5-6H,4H2,1-2H3,(H,15,19)(H,20,21) |
| InChIKey | ZKGPVFHSFQUPGJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|