C16H18ClN3O5 — CID 166396251
4-[[[2-chloro-4-(2-methoxyethoxy)benzoyl]amino]methyl]-1-methylpyrazole-5-carboxylic acid (PubChem CID 166396251) has the molecular formula C16H18ClN3O5 and a molecular weight of 367.79 g/mol. Its IUPAC name is 4-[[[2-chloro-4-(2-methoxyethoxy)benzoyl]amino]methyl]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-[[[2-chloro-4-(2-methoxyethoxy)benzoyl]amino]methyl]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 166396251 |
| Molecular Formula | C16H18ClN3O5 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-[[[2-chloro-4-(2-methoxyethoxy)benzoyl]amino]methyl]-1-methylpyrazole-5-carboxylic acid |
| SMILES | COCCOc1ccc(C(=O)NCc2cnn(C)c2C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClN3O5/c1-20-14(16(22)23)10(9-19-20)8-18-15(21)12-4-3-11(7-13(12)17)25-6-5-24-2/h3-4,7,9H,5-6,8H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | DKORWWYIOWEHLU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|