C18H22ClNOS — CID 167951935
1-bicyclo[1.1.0]butanyl-[2-[2-(4-chlorophenyl)sulfanylethyl]piperidin-1-yl]methanone (PubChem CID 167951935) has the molecular formula C18H22ClNOS and a molecular weight of 335.90 g/mol. Its IUPAC name is 1-bicyclo[1.1.0]butanyl-[2-[2-(4-chlorophenyl)sulfanylethyl]piperidin-1-yl]methanone.
| Compound Name | 1-bicyclo[1.1.0]butanyl-[2-[2-(4-chlorophenyl)sulfanylethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 167951935 |
| Molecular Formula | C18H22ClNOS |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-bicyclo[1.1.0]butanyl-[2-[2-(4-chlorophenyl)sulfanylethyl]piperidin-1-yl]methanone |
| SMILES | O=C(N1CCCCC1CCSc1ccc(Cl)cc1)C12CC1C2 |
| InChI | InChI=1S/C18H22ClNOS/c19-14-4-6-16(7-5-14)22-10-8-15-3-1-2-9-20(15)17(21)18-11-13(18)12-18/h4-7,13,15H,1-3,8-12H2 |
| InChIKey | ICRFYIWTYLBSHO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |