C18H22N2O5S — CID 167952164
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[(4-oxochromen-6-yl)amino]propanamide (PubChem CID 167952164) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[(4-oxochromen-6-yl)amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[(4-oxochromen-6-yl)amino]propanamide |
|---|---|
| PubChem CID | 167952164 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[(4-oxochromen-6-yl)amino]propanamide |
| SMILES | CCN(C(=O)C(C)Nc1ccc2occc(=O)c2c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H22N2O5S/c1-3-20(14-7-9-26(23,24)11-14)18(22)12(2)19-13-4-5-17-15(10-13)16(21)6-8-25-17/h4-6,8,10,12,14,19H,3,7,9,11H2,1-2H3 |
| InChIKey | HAIVZMHATZHEJD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |