C22H26N2O3S — CID 40820368
(2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(9H-fluoren-2-ylamino)propanamide (PubChem CID 40820368) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is (2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(9H-fluoren-2-ylamino)propanamide.
| Compound Name | (2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(9H-fluoren-2-ylamino)propanamide |
|---|---|
| PubChem CID | 40820368 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(9H-fluoren-2-ylamino)propanamide |
| SMILES | CCN(C(=O)[C@@H](C)Nc1ccc2c(c1)Cc1ccccc1-2)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H26N2O3S/c1-3-24(19-10-11-28(26,27)14-19)22(25)15(2)23-18-8-9-21-17(13-18)12-16-6-4-5-7-20(16)21/h4-9,13,15,19,23H,3,10-12,14H2,1-2H3/t15-,19+/m1/s1 |
| InChIKey | HMSPXYRJYSYVCC-BEFAXECRSA-N |
| XLogP | 3.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |