C15H20N2O5S — CID 167811081
2-(1,3-benzodioxol-5-ylamino)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide (PubChem CID 167811081) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 167811081 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide |
| SMILES | CC(Nc1ccc2c(c1)OCO2)C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20N2O5S/c1-10(15(18)17(2)12-5-6-23(19,20)8-12)16-11-3-4-13-14(7-11)22-9-21-13/h3-4,7,10,12,16H,5-6,8-9H2,1-2H3 |
| InChIKey | XNNNYHBLEZQYNV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|