C17H26N2O5S — CID 35960266
(2R)-2-(4,5-dimethoxy-2-methylanilino)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylpropanamide (PubChem CID 35960266) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is (2R)-2-(4,5-dimethoxy-2-methylanilino)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylpropanamide.
| Compound Name | (2R)-2-(4,5-dimethoxy-2-methylanilino)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 35960266 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (2R)-2-(4,5-dimethoxy-2-methylanilino)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylpropanamide |
| SMILES | COc1cc(C)c(N[C@H](C)C(=O)N(C)[C@H]2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C17H26N2O5S/c1-11-8-15(23-4)16(24-5)9-14(11)18-12(2)17(20)19(3)13-6-7-25(21,22)10-13/h8-9,12-13,18H,6-7,10H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | REWVLTIDWFKAKT-OLZOCXBDSA-N |
| XLogP | 1.46 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|