C12H13N3OS2 — CID 167952929
N-(5-ethyl-1,2,4-thiadiazol-3-yl)-2-phenylsulfanylacetamide (PubChem CID 167952929) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is N-(5-ethyl-1,2,4-thiadiazol-3-yl)-2-phenylsulfanylacetamide.
| Compound Name | N-(5-ethyl-1,2,4-thiadiazol-3-yl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 167952929 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | N-(5-ethyl-1,2,4-thiadiazol-3-yl)-2-phenylsulfanylacetamide |
| SMILES | CCc1nc(NC(=O)CSc2ccccc2)ns1 |
| InChI | InChI=1S/C12H13N3OS2/c1-2-11-14-12(15-18-11)13-10(16)8-17-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,13,15,16) |
| InChIKey | MLQYDFPYSFEDJJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |