C12H12N2OS2 — CID 71900557
N-(3-methyl-1,2-thiazol-5-yl)-2-phenylsulfanylacetamide (PubChem CID 71900557) has the molecular formula C12H12N2OS2 and a molecular weight of 264.38 g/mol. Its IUPAC name is N-(3-methyl-1,2-thiazol-5-yl)-2-phenylsulfanylacetamide.
| Compound Name | N-(3-methyl-1,2-thiazol-5-yl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 71900557 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | N-(3-methyl-1,2-thiazol-5-yl)-2-phenylsulfanylacetamide |
| SMILES | Cc1cc(NC(=O)CSc2ccccc2)sn1 |
| InChI | InChI=1S/C12H12N2OS2/c1-9-7-12(17-14-9)13-11(15)8-16-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,13,15) |
| InChIKey | QFUUTAUECFONSI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |