C8H14N2S — CID 16795633
N,N-dimethyl-1-thiophen-3-ylethane-1,2-diamine (PubChem CID 16795633) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is N,N-dimethyl-1-thiophen-3-ylethane-1,2-diamine.
| Compound Name | N,N-dimethyl-1-thiophen-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 16795633 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | N,N-dimethyl-1-thiophen-3-ylethane-1,2-diamine |
| SMILES | CN(C)C(CN)c1ccsc1 |
| InChI | InChI=1S/C8H14N2S/c1-10(2)8(5-9)7-3-4-11-6-7/h3-4,6,8H,5,9H2,1-2H3 |
| InChIKey | JLSSIEXZXYNSOE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |