C16H24N2 — CID 167959230
N-(1,2,3,4-tetrahydroquinolin-5-ylmethyl)hex-5-en-2-amine (PubChem CID 167959230) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroquinolin-5-ylmethyl)hex-5-en-2-amine.
| Compound Name | N-(1,2,3,4-tetrahydroquinolin-5-ylmethyl)hex-5-en-2-amine |
|---|---|
| PubChem CID | 167959230 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-(1,2,3,4-tetrahydroquinolin-5-ylmethyl)hex-5-en-2-amine |
| SMILES | C=CCCC(C)NCc1cccc2c1CCCN2 |
| InChI | InChI=1S/C16H24N2/c1-3-4-7-13(2)18-12-14-8-5-10-16-15(14)9-6-11-17-16/h3,5,8,10,13,17-18H,1,4,6-7,9,11-12H2,2H3 |
| InChIKey | KQIAUWIINMTCBT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|