C16H19ClF2N2O3 — CID 167960351
[(3R,8aS)-3-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-chloro-4-(difluoromethoxy)phenyl]methanone (PubChem CID 167960351) has the molecular formula C16H19ClF2N2O3 and a molecular weight of 360.79 g/mol. Its IUPAC name is [(3R,8aS)-3-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-chloro-4-(difluoromethoxy)phenyl]methanone.
| Compound Name | [(3R,8aS)-3-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-chloro-4-(difluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 167960351 |
| Molecular Formula | C16H19ClF2N2O3 |
| Molecular Weight | 360.79 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [(3R,8aS)-3-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-chloro-4-(difluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OC(F)F)c(Cl)c1)N1C[C@@H]2CCCN2C[C@@H]1CO |
| InChI | InChI=1S/C16H19ClF2N2O3/c17-13-6-10(3-4-14(13)24-16(18)19)15(23)21-8-11-2-1-5-20(11)7-12(21)9-22/h3-4,6,11-12,16,22H,1-2,5,7-9H2/t11-,12+/m0/s1 |
| InChIKey | VXDRAZKDRSGSDQ-NWDGAFQWSA-N |
| XLogP | 2.22 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |