C14H8F5N3O4S — CID 16796268
4-methyl-3-nitro-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzenesulfonamide (PubChem CID 16796268) has the molecular formula C14H8F5N3O4S and a molecular weight of 409.29 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-methyl-3-nitro-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 16796268 |
| Molecular Formula | C14H8F5N3O4S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 4-methyl-3-nitro-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/c2c(F)c(F)c(F)c(F)c2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8F5N3O4S/c1-6-2-3-7(4-9(6)22(23)24)27(25,26)21-20-5-8-10(15)12(17)14(19)13(18)11(8)16/h2-5,21H,1H3/b20-5+ |
| InChIKey | DTHXPUGRTGZCBL-DENHBWNVSA-N |
| XLogP | 2.91 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|