C16H13BrN4O4S — CID 135892483
N-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 135892483) has the molecular formula C16H13BrN4O4S and a molecular weight of 437.28 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135892483 |
| Molecular Formula | C16H13BrN4O4S |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | N-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C\c2c[nH]c3ccc(Br)cc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13BrN4O4S/c1-10-2-4-13(7-16(10)21(22)23)26(24,25)20-19-9-11-8-18-15-5-3-12(17)6-14(11)15/h2-9,18,20H,1H3/b19-9- |
| InChIKey | OQJCGZXUVSFNJV-OCKHKDLRSA-N |
| XLogP | 3.46 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|