C14H13F2N3O5S2 — CID 9070203
N-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 9070203) has the molecular formula C14H13F2N3O5S2 and a molecular weight of 405.40 g/mol. Its IUPAC name is N-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9070203 |
| Molecular Formula | C14H13F2N3O5S2 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | N-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C\c2ccc(CSC(F)F)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13F2N3O5S2/c1-9-2-5-12(6-13(9)19(20)21)26(22,23)18-17-7-10-3-4-11(24-10)8-25-14(15)16/h2-7,14,18H,8H2,1H3/b17-7- |
| InChIKey | FXHONYWUIBLMOH-IDUWFGFVSA-N |
| XLogP | 3.26 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|