C17H18F3N3O — CID 167962982
2-(2-pyrimidin-2-ylpyrrolidin-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanol (PubChem CID 167962982) has the molecular formula C17H18F3N3O and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-(2-pyrimidin-2-ylpyrrolidin-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-(2-pyrimidin-2-ylpyrrolidin-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 167962982 |
| Molecular Formula | C17H18F3N3O |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-(2-pyrimidin-2-ylpyrrolidin-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanol |
| SMILES | OC(CN1CCCC1c1ncccn1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18F3N3O/c18-17(19,20)13-6-4-12(5-7-13)15(24)11-23-10-1-3-14(23)16-21-8-2-9-22-16/h2,4-9,14-15,24H,1,3,10-11H2 |
| InChIKey | VSKDZRPRDISKNP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |