C19H22FN5O3 — CID 167964308
N-(1-tert-butylpyrazol-3-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 167964308) has the molecular formula C19H22FN5O3 and a molecular weight of 387.42 g/mol. Its IUPAC name is N-(1-tert-butylpyrazol-3-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(1-tert-butylpyrazol-3-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 167964308 |
| Molecular Formula | C19H22FN5O3 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-(1-tert-butylpyrazol-3-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2ccn(C(C)(C)C)n2)C1=O |
| InChI | InChI=1S/C19H22FN5O3/c1-18(2,3)25-10-9-14(23-25)21-15(26)11-24-16(27)19(4,22-17(24)28)12-5-7-13(20)8-6-12/h5-10H,11H2,1-4H3,(H,22,28)(H,21,23,26) |
| InChIKey | WPLOASKEMGXKRK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|