C12H11ClFN5O2 — CID 167967030
N-(2-chloro-4-fluorophenyl)-N'-[1-(1H-1,2,4-triazol-5-yl)ethyl]oxamide (PubChem CID 167967030) has the molecular formula C12H11ClFN5O2 and a molecular weight of 311.70 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-N'-[1-(1H-1,2,4-triazol-5-yl)ethyl]oxamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-N'-[1-(1H-1,2,4-triazol-5-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 167967030 |
| Molecular Formula | C12H11ClFN5O2 |
| Molecular Weight | 311.70 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-N'-[1-(1H-1,2,4-triazol-5-yl)ethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)Nc1ccc(F)cc1Cl)c1ncn[nH]1 |
| InChI | InChI=1S/C12H11ClFN5O2/c1-6(10-15-5-16-19-10)17-11(20)12(21)18-9-3-2-7(14)4-8(9)13/h2-6H,1H3,(H,17,20)(H,18,21)(H,15,16,19) |
| InChIKey | GXENPBSTOKJFFC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.70 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|