C15H23N7S — CID 167969747
N-[(4-aminopyrimidin-2-yl)methyl]-N-methyl-1-(thiadiazol-4-ylmethyl)azepan-4-amine (PubChem CID 167969747) has the molecular formula C15H23N7S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[(4-aminopyrimidin-2-yl)methyl]-N-methyl-1-(thiadiazol-4-ylmethyl)azepan-4-amine.
| Compound Name | N-[(4-aminopyrimidin-2-yl)methyl]-N-methyl-1-(thiadiazol-4-ylmethyl)azepan-4-amine |
|---|---|
| PubChem CID | 167969747 |
| Molecular Formula | C15H23N7S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-[(4-aminopyrimidin-2-yl)methyl]-N-methyl-1-(thiadiazol-4-ylmethyl)azepan-4-amine |
| SMILES | CN(Cc1nccc(N)n1)C1CCCN(Cc2csnn2)CC1 |
| InChI | InChI=1S/C15H23N7S/c1-21(10-15-17-6-4-14(16)18-15)13-3-2-7-22(8-5-13)9-12-11-23-20-19-12/h4,6,11,13H,2-3,5,7-10H2,1H3,(H2,16,17,18) |
| InChIKey | UDSHAXAKUQCYNM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |