C19H21BrN2OS — CID 167970093
N-(2-bromo-4-methylphenyl)-3-(4-methylphenyl)thiomorpholine-4-carboxamide (PubChem CID 167970093) has the molecular formula C19H21BrN2OS and a molecular weight of 405.36 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-3-(4-methylphenyl)thiomorpholine-4-carboxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-3-(4-methylphenyl)thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 167970093 |
| Molecular Formula | C19H21BrN2OS |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-3-(4-methylphenyl)thiomorpholine-4-carboxamide |
| SMILES | Cc1ccc(C2CSCCN2C(=O)Nc2ccc(C)cc2Br)cc1 |
| InChI | InChI=1S/C19H21BrN2OS/c1-13-3-6-15(7-4-13)18-12-24-10-9-22(18)19(23)21-17-8-5-14(2)11-16(17)20/h3-8,11,18H,9-10,12H2,1-2H3,(H,21,23) |
| InChIKey | QHSTXADOEKPHSH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |