C19H21NO4S — CID 167970130
4-[(3-cyclopropylphenyl)sulfonylamino]-4-phenylbutanoic acid (PubChem CID 167970130) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-[(3-cyclopropylphenyl)sulfonylamino]-4-phenylbutanoic acid.
| Compound Name | 4-[(3-cyclopropylphenyl)sulfonylamino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 167970130 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-[(3-cyclopropylphenyl)sulfonylamino]-4-phenylbutanoic acid |
| SMILES | O=C(O)CCC(NS(=O)(=O)c1cccc(C2CC2)c1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO4S/c21-19(22)12-11-18(15-5-2-1-3-6-15)20-25(23,24)17-8-4-7-16(13-17)14-9-10-14/h1-8,13-14,18,20H,9-12H2,(H,21,22) |
| InChIKey | VKDPWJOAVYKPJM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |