About 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid
6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid (PubChem CID 167970296) has the molecular formula C14H20FN3O3
and a molecular weight of 297.33 g/mol. Its IUPAC name is 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid |
| PubChem CID | 167970296 |
| Molecular Formula | C14H20FN3O3 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid |
| SMILES | CC(C)(C)O[C@H]1C[C@@H](F)CN(c2cc(C(=O)O)ncn2)C1 |
| InChI | InChI=1S/C14H20FN3O3/c1-14(2,3)21-10-4-9(15)6-18(7-10)12-5-11(13(19)20)16-8-17-12/h5,8-10H,4,6-7H2,1-3H3,(H,19,20)/t9-,10+/m1/s1 |
| InChIKey | COORRGHJRDEQAJ-ZJUUUORDSA-N |
| XLogP | 1.91 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid?
The IUPAC name of 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid (CID 167970296) is 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid.
What is the SMILES notation for 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid?
The canonical SMILES for 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid is CC(C)(C)O[C@H]1C[C@@H](F)CN(c2cc(C(=O)O)ncn2)C1.
What is the InChIKey of 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid?
The InChIKey is COORRGHJRDEQAJ-ZJUUUORDSA-N. The full InChI is InChI=1S/C14H20FN3O3/c1-14(2,3)21-10-4-9(15)6-18(7-10)12-5-11(13(19)20)16-8-17-12/h5,8-10H,4,6-7H2,1-3H3,(H,19,20)/t9-,10+/m1/s1.
What are the key properties of 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid?
6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid has a molecular weight of 297.33 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3R,5S)-3-fluoro-5-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]pyrimidine-4-carboxylic acid is sourced from PubChem (CID 167970296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).