C15H23N5O2 — CID 167971094
(1R,2R,4S)-4-(5-ethyl-1H-1,2,4-triazol-3-yl)-2-[[(5-methyl-1,3-oxazol-2-yl)methylamino]methyl]cyclopentan-1-ol (PubChem CID 167971094) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (1R,2R,4S)-4-(5-ethyl-1H-1,2,4-triazol-3-yl)-2-[[(5-methyl-1,3-oxazol-2-yl)methylamino]methyl]cyclopentan-1-ol.
| Compound Name | (1R,2R,4S)-4-(5-ethyl-1H-1,2,4-triazol-3-yl)-2-[[(5-methyl-1,3-oxazol-2-yl)methylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 167971094 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (1R,2R,4S)-4-(5-ethyl-1H-1,2,4-triazol-3-yl)-2-[[(5-methyl-1,3-oxazol-2-yl)methylamino]methyl]cyclopentan-1-ol |
| SMILES | CCc1nc([C@H]2C[C@H](CNCc3ncc(C)o3)[C@H](O)C2)n[nH]1 |
| InChI | InChI=1S/C15H23N5O2/c1-3-13-18-15(20-19-13)10-4-11(12(21)5-10)7-16-8-14-17-6-9(2)22-14/h6,10-12,16,21H,3-5,7-8H2,1-2H3,(H,18,19,20)/t10-,11+,12+/m0/s1 |
| InChIKey | DFPZYSXODVOZOV-QJPTWQEYSA-N |
| XLogP | 1.31 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |