C11H12N2O — CID 167971280
6-ethenyl-8-methoxy-2-methylimidazo[1,2-a]pyridine (PubChem CID 167971280) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-ethenyl-8-methoxy-2-methylimidazo[1,2-a]pyridine.
| Compound Name | 6-ethenyl-8-methoxy-2-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 167971280 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 6-ethenyl-8-methoxy-2-methylimidazo[1,2-a]pyridine |
| SMILES | C=Cc1cc(OC)c2nc(C)cn2c1 |
| InChI | InChI=1S/C11H12N2O/c1-4-9-5-10(14-3)11-12-8(2)6-13(11)7-9/h4-7H,1H2,2-3H3 |
| InChIKey | IRDQUKHOTANQNS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |