C18H18FN5O3 — CID 167973545
N-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-2-(furan-2-ylmethylcarbamoylamino)acetamide (PubChem CID 167973545) has the molecular formula C18H18FN5O3 and a molecular weight of 371.37 g/mol. Its IUPAC name is N-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-2-(furan-2-ylmethylcarbamoylamino)acetamide.
| Compound Name | N-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-2-(furan-2-ylmethylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 167973545 |
| Molecular Formula | C18H18FN5O3 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-2-(furan-2-ylmethylcarbamoylamino)acetamide |
| SMILES | O=C(CNC(=O)NCc1ccco1)NCc1ccn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H18FN5O3/c19-13-3-5-15(6-4-13)24-8-7-14(23-24)10-20-17(25)12-22-18(26)21-11-16-2-1-9-27-16/h1-9H,10-12H2,(H,20,25)(H2,21,22,26) |
| InChIKey | HFHHOKLENTVSFX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |