C19H15N5O5S2 — CID 16797481
[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 16797481) has the molecular formula C19H15N5O5S2 and a molecular weight of 457.49 g/mol. Its IUPAC name is [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 16797481 |
| Molecular Formula | C19H15N5O5S2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(C)c2sc(C(=O)OCC(=O)Nc3nc(-c4cccc([N+](=O)[O-])c4)cs3)cc12 |
| InChI | InChI=1S/C19H15N5O5S2/c1-10-13-7-15(31-17(13)23(2)22-10)18(26)29-8-16(25)21-19-20-14(9-30-19)11-4-3-5-12(6-11)24(27)28/h3-7,9H,8H2,1-2H3,(H,20,21,25) |
| InChIKey | JMKGULMOSKKZJM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|