C24H22N4O5S — CID 167974850
3-(2,4-dioxoquinazolin-1-yl)-N-[4-[(2-methylphenyl)sulfonylamino]phenyl]propanamide (PubChem CID 167974850) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is 3-(2,4-dioxoquinazolin-1-yl)-N-[4-[(2-methylphenyl)sulfonylamino]phenyl]propanamide.
| Compound Name | 3-(2,4-dioxoquinazolin-1-yl)-N-[4-[(2-methylphenyl)sulfonylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 167974850 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-(2,4-dioxoquinazolin-1-yl)-N-[4-[(2-methylphenyl)sulfonylamino]phenyl]propanamide |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1ccc(NC(=O)CCn2c(=O)[nH]c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H22N4O5S/c1-16-6-2-5-9-21(16)34(32,33)27-18-12-10-17(11-13-18)25-22(29)14-15-28-20-8-4-3-7-19(20)23(30)26-24(28)31/h2-13,27H,14-15H2,1H3,(H,25,29)(H,26,30,31) |
| InChIKey | VDAIKCXDQQRCNK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |