C24H21ClN4O3 — CID 60602373
N-[4-(benzylamino)-3-chlorophenyl]-3-(2,4-dioxoquinazolin-1-yl)propanamide (PubChem CID 60602373) has the molecular formula C24H21ClN4O3 and a molecular weight of 448.91 g/mol. Its IUPAC name is N-[4-(benzylamino)-3-chlorophenyl]-3-(2,4-dioxoquinazolin-1-yl)propanamide.
| Compound Name | N-[4-(benzylamino)-3-chlorophenyl]-3-(2,4-dioxoquinazolin-1-yl)propanamide |
|---|---|
| PubChem CID | 60602373 |
| Molecular Formula | C24H21ClN4O3 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N-[4-(benzylamino)-3-chlorophenyl]-3-(2,4-dioxoquinazolin-1-yl)propanamide |
| SMILES | O=C(CCn1c(=O)[nH]c(=O)c2ccccc21)Nc1ccc(NCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C24H21ClN4O3/c25-19-14-17(10-11-20(19)26-15-16-6-2-1-3-7-16)27-22(30)12-13-29-21-9-5-4-8-18(21)23(31)28-24(29)32/h1-11,14,26H,12-13,15H2,(H,27,30)(H,28,31,32) |
| InChIKey | FJDLKUXXTDZQEU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |