About 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea
1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea (PubChem CID 167976831) has the molecular formula C16H21N3O4
and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea.
Molecular Properties
| Compound Name | 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea |
| PubChem CID | 167976831 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea |
| SMILES | COC(C)(CNC(=O)Nc1cc(-c2ccoc2C)on1)C1CC1 |
| InChI | InChI=1S/C16H21N3O4/c1-10-12(6-7-22-10)13-8-14(19-23-13)18-15(20)17-9-16(2,21-3)11-4-5-11/h6-8,11H,4-5,9H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | BIMBMSABLRHOMB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea?
The IUPAC name of 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea (CID 167976831) is 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea.
What is the SMILES notation for 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea?
The canonical SMILES for 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea is COC(C)(CNC(=O)Nc1cc(-c2ccoc2C)on1)C1CC1.
What is the InChIKey of 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea?
The InChIKey is BIMBMSABLRHOMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O4/c1-10-12(6-7-22-10)13-8-14(19-23-13)18-15(20)17-9-16(2,21-3)11-4-5-11/h6-8,11H,4-5,9H2,1-3H3,(H2,17,18,19,20).
What are the key properties of 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea?
1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea has a molecular weight of 319.36 g/mol, XLogP of 3.18, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclopropyl-2-methoxypropyl)-3-[5-(2-methylfuran-3-yl)-1,2-oxazol-3-yl]urea is sourced from PubChem (CID 167976831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).