C17H21ClN4O2 — CID 146135202
1-[1-(4-chlorophenyl)pyrazol-3-yl]-3-(2-cyclopropyl-2-methoxypropyl)urea (PubChem CID 146135202) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)pyrazol-3-yl]-3-(2-cyclopropyl-2-methoxypropyl)urea.
| Compound Name | 1-[1-(4-chlorophenyl)pyrazol-3-yl]-3-(2-cyclopropyl-2-methoxypropyl)urea |
|---|---|
| PubChem CID | 146135202 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[1-(4-chlorophenyl)pyrazol-3-yl]-3-(2-cyclopropyl-2-methoxypropyl)urea |
| SMILES | COC(C)(CNC(=O)Nc1ccn(-c2ccc(Cl)cc2)n1)C1CC1 |
| InChI | InChI=1S/C17H21ClN4O2/c1-17(24-2,12-3-4-12)11-19-16(23)20-15-9-10-22(21-15)14-7-5-13(18)6-8-14/h5-10,12H,3-4,11H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | ZSBSEWHZFFVVRJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |