C13H13ClF2N4O3 — CID 167977039
1-[3-[chloro(difluoro)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]cyclopent-3-ene-1-carboxylic acid (PubChem CID 167977039) has the molecular formula C13H13ClF2N4O3 and a molecular weight of 346.72 g/mol. Its IUPAC name is 1-[3-[chloro(difluoro)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]cyclopent-3-ene-1-carboxylic acid.
| Compound Name | 1-[3-[chloro(difluoro)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]cyclopent-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 167977039 |
| Molecular Formula | C13H13ClF2N4O3 |
| Molecular Weight | 346.72 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 1-[3-[chloro(difluoro)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]cyclopent-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)N2CCn3c(nnc3C(F)(F)Cl)C2)CC=CC1 |
| InChI | InChI=1S/C13H13ClF2N4O3/c14-13(15,16)9-18-17-8-7-19(5-6-20(8)9)10(21)12(11(22)23)3-1-2-4-12/h1-2H,3-7H2,(H,22,23) |
| InChIKey | ZNBJSWDCGSJECJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.72 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|