C18H21F3N4O5 — CID 138033187
1-(4-pyridazin-3-yl-1,4-diazepane-1-carbonyl)cyclopent-3-ene-1-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 138033187) has the molecular formula C18H21F3N4O5 and a molecular weight of 430.38 g/mol. Its IUPAC name is 1-(4-pyridazin-3-yl-1,4-diazepane-1-carbonyl)cyclopent-3-ene-1-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(4-pyridazin-3-yl-1,4-diazepane-1-carbonyl)cyclopent-3-ene-1-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138033187 |
| Molecular Formula | C18H21F3N4O5 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-(4-pyridazin-3-yl-1,4-diazepane-1-carbonyl)cyclopent-3-ene-1-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C1(C(=O)N2CCCN(c3cccnn3)CC2)CC=CC1 |
| InChI | InChI=1S/C16H20N4O3.C2HF3O2/c21-14(16(15(22)23)6-1-2-7-16)20-10-4-9-19(11-12-20)13-5-3-8-17-18-13;3-2(4,5)1(6)7/h1-3,5,8H,4,6-7,9-12H2,(H,22,23);(H,6,7) |
| InChIKey | UCGSLAHMFUTMGO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|