C11H10N6O — CID 167977348
3-[(quinazolin-4-ylamino)methyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 167977348) has the molecular formula C11H10N6O and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-[(quinazolin-4-ylamino)methyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[(quinazolin-4-ylamino)methyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 167977348 |
| Molecular Formula | C11H10N6O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-[(quinazolin-4-ylamino)methyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(CNc2ncnc3ccccc23)[nH]1 |
| InChI | InChI=1S/C11H10N6O/c18-11-15-9(16-17-11)5-12-10-7-3-1-2-4-8(7)13-6-14-10/h1-4,6H,5H2,(H,12,13,14)(H2,15,16,17,18) |
| InChIKey | BLGBZEPPODCXPK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |