C16H17N5O3 — CID 154768726
1-(2-methoxyethyl)-5-[(quinazolin-4-ylamino)methyl]pyrimidine-2,4-dione (PubChem CID 154768726) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-[(quinazolin-4-ylamino)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-(2-methoxyethyl)-5-[(quinazolin-4-ylamino)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 154768726 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-(2-methoxyethyl)-5-[(quinazolin-4-ylamino)methyl]pyrimidine-2,4-dione |
| SMILES | COCCn1cc(CNc2ncnc3ccccc23)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H17N5O3/c1-24-7-6-21-9-11(15(22)20-16(21)23)8-17-14-12-4-2-3-5-13(12)18-10-19-14/h2-5,9-10H,6-8H2,1H3,(H,17,18,19)(H,20,22,23) |
| InChIKey | QTGDVSCDSIIFQR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |