C21H24N6O2 — CID 23293023
3-ethyl-8-[[2-(2-methoxyethylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one (PubChem CID 23293023) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-ethyl-8-[[2-(2-methoxyethylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one.
| Compound Name | 3-ethyl-8-[[2-(2-methoxyethylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one |
|---|---|
| PubChem CID | 23293023 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-ethyl-8-[[2-(2-methoxyethylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one |
| SMILES | CCn1c(=O)[nH]c2cc3c(NCc4ccccc4NCCOC)ncnc3cc21 |
| InChI | InChI=1S/C21H24N6O2/c1-3-27-19-11-17-15(10-18(19)26-21(27)28)20(25-13-24-17)23-12-14-6-4-5-7-16(14)22-8-9-29-2/h4-7,10-11,13,22H,3,8-9,12H2,1-2H3,(H,26,28)(H,23,24,25) |
| InChIKey | KHICUTYQKJKCDY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|