C16H22N6S — CID 22921728
8-[3-(dimethylamino)propylamino]-3-ethyl-1H-imidazo[4,5-g]quinazoline-2-thione (PubChem CID 22921728) has the molecular formula C16H22N6S and a molecular weight of 330.46 g/mol. Its IUPAC name is 8-[3-(dimethylamino)propylamino]-3-ethyl-1H-imidazo[4,5-g]quinazoline-2-thione.
| Compound Name | 8-[3-(dimethylamino)propylamino]-3-ethyl-1H-imidazo[4,5-g]quinazoline-2-thione |
|---|---|
| PubChem CID | 22921728 |
| Molecular Formula | C16H22N6S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 8-[3-(dimethylamino)propylamino]-3-ethyl-1H-imidazo[4,5-g]quinazoline-2-thione |
| SMILES | CCn1c(=S)[nH]c2cc3c(NCCCN(C)C)ncnc3cc21 |
| InChI | InChI=1S/C16H22N6S/c1-4-22-14-9-12-11(8-13(14)20-16(22)23)15(19-10-18-12)17-6-5-7-21(2)3/h8-10H,4-7H2,1-3H3,(H,20,23)(H,17,18,19) |
| InChIKey | BLJWTFPCOUFJQG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|