C23H28N6O2 — CID 21465406
8-[[2-[3-(dimethylamino)propoxy]phenyl]methylamino]-3-ethyl-1H-imidazo[4,5-g]quinazolin-2-one (PubChem CID 21465406) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 8-[[2-[3-(dimethylamino)propoxy]phenyl]methylamino]-3-ethyl-1H-imidazo[4,5-g]quinazolin-2-one.
| Compound Name | 8-[[2-[3-(dimethylamino)propoxy]phenyl]methylamino]-3-ethyl-1H-imidazo[4,5-g]quinazolin-2-one |
|---|---|
| PubChem CID | 21465406 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 8-[[2-[3-(dimethylamino)propoxy]phenyl]methylamino]-3-ethyl-1H-imidazo[4,5-g]quinazolin-2-one |
| SMILES | CCn1c(=O)[nH]c2cc3c(NCc4ccccc4OCCCN(C)C)ncnc3cc21 |
| InChI | InChI=1S/C23H28N6O2/c1-4-29-20-13-18-17(12-19(20)27-23(29)30)22(26-15-25-18)24-14-16-8-5-6-9-21(16)31-11-7-10-28(2)3/h5-6,8-9,12-13,15H,4,7,10-11,14H2,1-3H3,(H,27,30)(H,24,25,26) |
| InChIKey | UMCZVXNMHSQBPJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|