C18H20Cl2N6S — CID 22921729
3-ethyl-8-(2-pyridin-2-ylethylamino)-1H-imidazo[4,5-g]quinazoline-2-thione;dihydrochloride (PubChem CID 22921729) has the molecular formula C18H20Cl2N6S and a molecular weight of 423.37 g/mol. Its IUPAC name is 3-ethyl-8-(2-pyridin-2-ylethylamino)-1H-imidazo[4,5-g]quinazoline-2-thione;dihydrochloride.
| Compound Name | 3-ethyl-8-(2-pyridin-2-ylethylamino)-1H-imidazo[4,5-g]quinazoline-2-thione;dihydrochloride |
|---|---|
| PubChem CID | 22921729 |
| Molecular Formula | C18H20Cl2N6S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 3-ethyl-8-(2-pyridin-2-ylethylamino)-1H-imidazo[4,5-g]quinazoline-2-thione;dihydrochloride |
| SMILES | CCn1c(=S)[nH]c2cc3c(NCCc4ccccn4)ncnc3cc21.Cl.Cl |
| InChI | InChI=1S/C18H18N6S.2ClH/c1-2-24-16-10-14-13(9-15(16)23-18(24)25)17(22-11-21-14)20-8-6-12-5-3-4-7-19-12;;/h3-5,7,9-11H,2,6,8H2,1H3,(H,23,25)(H,20,21,22);2*1H |
| InChIKey | QFXLVJDDJUAXRG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|