C18H21N5S — CID 22921762
8-(2-bicyclo[2.2.1]heptanylamino)-3-ethyl-1H-imidazo[4,5-g]quinazoline-2-thione (PubChem CID 22921762) has the molecular formula C18H21N5S and a molecular weight of 339.47 g/mol. Its IUPAC name is 8-(2-bicyclo[2.2.1]heptanylamino)-3-ethyl-1H-imidazo[4,5-g]quinazoline-2-thione.
| Compound Name | 8-(2-bicyclo[2.2.1]heptanylamino)-3-ethyl-1H-imidazo[4,5-g]quinazoline-2-thione |
|---|---|
| PubChem CID | 22921762 |
| Molecular Formula | C18H21N5S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 8-(2-bicyclo[2.2.1]heptanylamino)-3-ethyl-1H-imidazo[4,5-g]quinazoline-2-thione |
| SMILES | CCn1c(=S)[nH]c2cc3c(NC4CC5CCC4C5)ncnc3cc21 |
| InChI | InChI=1S/C18H21N5S/c1-2-23-16-8-14-12(7-15(16)22-18(23)24)17(20-9-19-14)21-13-6-10-3-4-11(13)5-10/h7-11,13H,2-6H2,1H3,(H,22,24)(H,19,20,21) |
| InChIKey | PIKOHZUXXMOJLR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|