C20H21N5OS — CID 102381738
8-(4-methoxyanilino)-3-(2-methylpropyl)-1H-imidazo[4,5-g]quinazoline-2-thione (PubChem CID 102381738) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 8-(4-methoxyanilino)-3-(2-methylpropyl)-1H-imidazo[4,5-g]quinazoline-2-thione.
| Compound Name | 8-(4-methoxyanilino)-3-(2-methylpropyl)-1H-imidazo[4,5-g]quinazoline-2-thione |
|---|---|
| PubChem CID | 102381738 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 8-(4-methoxyanilino)-3-(2-methylpropyl)-1H-imidazo[4,5-g]quinazoline-2-thione |
| SMILES | COc1ccc(Nc2ncnc3cc4c(cc23)[nH]c(=S)n4CC(C)C)cc1 |
| InChI | InChI=1S/C20H21N5OS/c1-12(2)10-25-18-9-16-15(8-17(18)24-20(25)27)19(22-11-21-16)23-13-4-6-14(26-3)7-5-13/h4-9,11-12H,10H2,1-3H3,(H,24,27)(H,21,22,23) |
| InChIKey | VEWOUIDQISBCOD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|