C16H15N5S2 — CID 57098572
3-ethyl-8-(thiophen-2-ylmethylamino)-1H-imidazo[4,5-g]quinazoline-2-thione (PubChem CID 57098572) has the molecular formula C16H15N5S2 and a molecular weight of 341.47 g/mol. Its IUPAC name is 3-ethyl-8-(thiophen-2-ylmethylamino)-1H-imidazo[4,5-g]quinazoline-2-thione.
| Compound Name | 3-ethyl-8-(thiophen-2-ylmethylamino)-1H-imidazo[4,5-g]quinazoline-2-thione |
|---|---|
| PubChem CID | 57098572 |
| Molecular Formula | C16H15N5S2 |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 3-ethyl-8-(thiophen-2-ylmethylamino)-1H-imidazo[4,5-g]quinazoline-2-thione |
| SMILES | CCn1c(=S)[nH]c2cc3c(NCc4cccs4)ncnc3cc21 |
| InChI | InChI=1S/C16H15N5S2/c1-2-21-14-7-12-11(6-13(14)20-16(21)22)15(19-9-18-12)17-8-10-4-3-5-23-10/h3-7,9H,2,8H2,1H3,(H,20,22)(H,17,18,19) |
| InChIKey | QNEOXWKBIVATDY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|