C16H19N5S — CID 22921780
3-ethyl-8-piperidin-1-yl-1H-imidazo[4,5-g]quinazoline-2-thione (PubChem CID 22921780) has the molecular formula C16H19N5S and a molecular weight of 313.43 g/mol. Its IUPAC name is 3-ethyl-8-piperidin-1-yl-1H-imidazo[4,5-g]quinazoline-2-thione.
| Compound Name | 3-ethyl-8-piperidin-1-yl-1H-imidazo[4,5-g]quinazoline-2-thione |
|---|---|
| PubChem CID | 22921780 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3-ethyl-8-piperidin-1-yl-1H-imidazo[4,5-g]quinazoline-2-thione |
| SMILES | CCn1c(=S)[nH]c2cc3c(N4CCCCC4)ncnc3cc21 |
| InChI | InChI=1S/C16H19N5S/c1-2-21-14-9-12-11(8-13(14)19-16(21)22)15(18-10-17-12)20-6-4-3-5-7-20/h8-10H,2-7H2,1H3,(H,19,22) |
| InChIKey | AISSJNLKSBIKLZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|