C25H29N7O2S — CID 23292974
ethyl 4-[2-[[(3-ethyl-2-sulfanylidene-1H-imidazo[4,5-g]quinazolin-8-yl)amino]methyl]phenyl]piperazine-1-carboxylate (PubChem CID 23292974) has the molecular formula C25H29N7O2S and a molecular weight of 491.62 g/mol. Its IUPAC name is ethyl 4-[2-[[(3-ethyl-2-sulfanylidene-1H-imidazo[4,5-g]quinazolin-8-yl)amino]methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[[(3-ethyl-2-sulfanylidene-1H-imidazo[4,5-g]quinazolin-8-yl)amino]methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 23292974 |
| Molecular Formula | C25H29N7O2S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | ethyl 4-[2-[[(3-ethyl-2-sulfanylidene-1H-imidazo[4,5-g]quinazolin-8-yl)amino]methyl]phenyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccccc2CNc2ncnc3cc4c(cc23)[nH]c(=S)n4CC)CC1 |
| InChI | InChI=1S/C25H29N7O2S/c1-3-32-22-14-19-18(13-20(22)29-24(32)35)23(28-16-27-19)26-15-17-7-5-6-8-21(17)30-9-11-31(12-10-30)25(33)34-4-2/h5-8,13-14,16H,3-4,9-12,15H2,1-2H3,(H,29,35)(H,26,27,28) |
| InChIKey | UHMYMQWTZGGGHI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|