C18H24N6S — CID 22921868
3-ethyl-8-[2-(1-methylpyrrolidin-2-yl)ethylamino]-1H-imidazo[4,5-g]quinazoline-2-thione (PubChem CID 22921868) has the molecular formula C18H24N6S and a molecular weight of 356.50 g/mol. Its IUPAC name is 3-ethyl-8-[2-(1-methylpyrrolidin-2-yl)ethylamino]-1H-imidazo[4,5-g]quinazoline-2-thione.
| Compound Name | 3-ethyl-8-[2-(1-methylpyrrolidin-2-yl)ethylamino]-1H-imidazo[4,5-g]quinazoline-2-thione |
|---|---|
| PubChem CID | 22921868 |
| Molecular Formula | C18H24N6S |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 3-ethyl-8-[2-(1-methylpyrrolidin-2-yl)ethylamino]-1H-imidazo[4,5-g]quinazoline-2-thione |
| SMILES | CCn1c(=S)[nH]c2cc3c(NCCC4CCCN4C)ncnc3cc21 |
| InChI | InChI=1S/C18H24N6S/c1-3-24-16-10-14-13(9-15(16)22-18(24)25)17(21-11-20-14)19-7-6-12-5-4-8-23(12)2/h9-12H,3-8H2,1-2H3,(H,22,25)(H,19,20,21) |
| InChIKey | UKDPRBOTWINAOJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|