C12H15N3O4 — CID 167981476
5-(5,8-dioxaspiro[3.5]nonan-2-ylamino)pyrazine-2-carboxylic acid (PubChem CID 167981476) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 5-(5,8-dioxaspiro[3.5]nonan-2-ylamino)pyrazine-2-carboxylic acid.
| Compound Name | 5-(5,8-dioxaspiro[3.5]nonan-2-ylamino)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 167981476 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 5-(5,8-dioxaspiro[3.5]nonan-2-ylamino)pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(NC2CC3(COCCO3)C2)cn1 |
| InChI | InChI=1S/C12H15N3O4/c16-11(17)9-5-14-10(6-13-9)15-8-3-12(4-8)7-18-1-2-19-12/h5-6,8H,1-4,7H2,(H,14,15)(H,16,17) |
| InChIKey | YSGDYELBHCLKRN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |