About 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid
5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid (PubChem CID 122058090) has the molecular formula C11H14N4O3
and a molecular weight of 250.26 g/mol. Its IUPAC name is 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid |
| PubChem CID | 122058090 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid |
| SMILES | NC(=O)[C@@H]1CC[C@H](Nc2cnc(C(=O)O)cn2)C1 |
| InChI | InChI=1S/C11H14N4O3/c12-10(16)6-1-2-7(3-6)15-9-5-13-8(4-14-9)11(17)18/h4-7H,1-3H2,(H2,12,16)(H,14,15)(H,17,18)/t6-,7+/m1/s1 |
| InChIKey | CGJSCJLTVFXCBW-RQJHMYQMSA-N |
| XLogP | 0.24 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid?
The IUPAC name of 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid (CID 122058090) is 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid.
What is the SMILES notation for 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid?
The canonical SMILES for 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid is NC(=O)[C@@H]1CC[C@H](Nc2cnc(C(=O)O)cn2)C1.
What is the InChIKey of 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid?
The InChIKey is CGJSCJLTVFXCBW-RQJHMYQMSA-N. The full InChI is InChI=1S/C11H14N4O3/c12-10(16)6-1-2-7(3-6)15-9-5-13-8(4-14-9)11(17)18/h4-7H,1-3H2,(H2,12,16)(H,14,15)(H,17,18)/t6-,7+/m1/s1.
What are the key properties of 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid?
5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid has a molecular weight of 250.26 g/mol, XLogP of 0.24, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1S,3R)-3-carbamoylcyclopentyl]amino]pyrazine-2-carboxylic acid is sourced from PubChem (CID 122058090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).