About 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid
5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid (PubChem CID 166402145) has the molecular formula C14H12FN3O3
and a molecular weight of 289.27 g/mol. Its IUPAC name is 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid |
| PubChem CID | 166402145 |
| Molecular Formula | C14H12FN3O3 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(NC2COc3cc(F)ccc3C2)cn1 |
| InChI | InChI=1S/C14H12FN3O3/c15-9-2-1-8-3-10(7-21-12(8)4-9)18-13-6-16-11(5-17-13)14(19)20/h1-2,4-6,10H,3,7H2,(H,17,18)(H,19,20) |
| InChIKey | FCMYXLHLBQPBAX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid?
The IUPAC name of 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid (CID 166402145) is 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid.
What is the SMILES notation for 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid?
The canonical SMILES for 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid is O=C(O)c1cnc(NC2COc3cc(F)ccc3C2)cn1.
What is the InChIKey of 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid?
The InChIKey is FCMYXLHLBQPBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3O3/c15-9-2-1-8-3-10(7-21-12(8)4-9)18-13-6-16-11(5-17-13)14(19)20/h1-2,4-6,10H,3,7H2,(H,17,18)(H,19,20).
What are the key properties of 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid?
5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid has a molecular weight of 289.27 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(7-fluoro-3,4-dihydro-2H-chromen-3-yl)amino]pyrazine-2-carboxylic acid is sourced from PubChem (CID 166402145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).