C14H15N3O3S — CID 122058019
5-[(2-thiophen-2-yloxan-4-yl)amino]pyrazine-2-carboxylic acid (PubChem CID 122058019) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 5-[(2-thiophen-2-yloxan-4-yl)amino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[(2-thiophen-2-yloxan-4-yl)amino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122058019 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 5-[(2-thiophen-2-yloxan-4-yl)amino]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(NC2CCOC(c3cccs3)C2)cn1 |
| InChI | InChI=1S/C14H15N3O3S/c18-14(19)10-7-16-13(8-15-10)17-9-3-4-20-11(6-9)12-2-1-5-21-12/h1-2,5,7-9,11H,3-4,6H2,(H,16,17)(H,18,19) |
| InChIKey | QYAHMSVYMNVTRI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |